C26H38ClNO8S2 — CID 10188725
[[(Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]methyl acetate (PubChem CID 10188725) has the molecular formula C26H38ClNO8S2 and a molecular weight of 592.18 g/mol. Its IUPAC name is [[(Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]methyl acetate.
| Compound Name | [[(Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]methyl acetate |
|---|---|
| PubChem CID | 10188725 |
| Molecular Formula | C26H38ClNO8S2 |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | [[(Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]methyl acetate |
| SMILES | CC(=O)OCN(C(=O)CCC/C=C\C[C@H]1[C@H](/C=C/[C@H](O)CCc2cc(Cl)c(C)s2)[C@@H](O)C[C@H]1O)S(C)(=O)=O |
| InChI | InChI=1S/C26H38ClNO8S2/c1-17-23(27)14-20(37-17)12-10-19(30)11-13-22-21(24(31)15-25(22)32)8-6-4-5-7-9-26(33)28(38(3,34)35)16-36-18(2)29/h4,6,11,13-14,19,21-22,24-25,30-32H,5,7-10,12,15-16H2,1-3H3/b6-4-,13-11+/t19-,21+,22+,24-,25+/m1/s1 |
| InChIKey | PEXAIRDOSAURSL-MYDMIOHFSA-N |
| XLogP | 3.34 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|