C25H36BrNO8S2 — CID 10282641
methyl 2-[[(E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(5-bromothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]acetate (PubChem CID 10282641) has the molecular formula C25H36BrNO8S2 and a molecular weight of 622.60 g/mol. Its IUPAC name is methyl 2-[[(E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(5-bromothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]acetate.
| Compound Name | methyl 2-[[(E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(5-bromothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]acetate |
|---|---|
| PubChem CID | 10282641 |
| Molecular Formula | C25H36BrNO8S2 |
| Molecular Weight | 622.60 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | methyl 2-[[(E)-7-[(1R,2R,3R,5S)-2-[(E,3S)-5-(5-bromothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]-methylsulfonylamino]acetate |
| SMILES | COC(=O)CN(C(=O)CCC/C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCc2ccc(Br)s2)[C@H](O)C[C@@H]1O)S(C)(=O)=O |
| InChI | InChI=1S/C25H36BrNO8S2/c1-35-25(32)16-27(37(2,33)34)24(31)8-6-4-3-5-7-19-20(22(30)15-21(19)29)13-10-17(28)9-11-18-12-14-23(26)36-18/h3,5,10,12-14,17,19-22,28-30H,4,6-9,11,15-16H2,1-2H3/b5-3+,13-10+/t17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | FDRDDXSITBKMNN-PSJORELUSA-N |
| XLogP | 2.80 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|