C25H35BrO4S — CID 58601341
methyl (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 58601341) has the molecular formula C25H35BrO4S and a molecular weight of 511.52 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58601341 |
| Molecular Formula | C25H35BrO4S |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | methyl (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | C=CC1CC(O)[C@H](C/C=C\CCCC(=O)OC)[C@H]1/C=C/[C@@H](O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C25H35BrO4S/c1-4-18-15-24(28)22(9-7-5-6-8-10-25(29)30-3)21(18)14-12-19(27)11-13-20-16-23(26)17(2)31-20/h4-5,7,12,14,16,18-19,21-22,24,27-28H,1,6,8-11,13,15H2,2-3H3/b7-5-,14-12+/t18?,19-,21-,22+,24?/m0/s1 |
| InChIKey | QZUGHHCXFQACHT-MPAHKLBMSA-N |
| XLogP | 5.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|