C26H38BrNO3S — CID 11713397
(Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]-N-ethylhept-5-enamide (PubChem CID 11713397) has the molecular formula C26H38BrNO3S and a molecular weight of 524.57 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 11713397 |
| Molecular Formula | C26H38BrNO3S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]-N-ethylhept-5-enamide |
| SMILES | C=CC1CC(O)[C@H](C/C=C\CCCC(=O)NCC)[C@H]1/C=C/[C@@H](O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C26H38BrNO3S/c1-4-19-16-25(30)23(10-8-6-7-9-11-26(31)28-5-2)22(19)15-13-20(29)12-14-21-17-24(27)18(3)32-21/h4,6,8,13,15,17,19-20,22-23,25,29-30H,1,5,7,9-12,14,16H2,2-3H3,(H,28,31)/b8-6-,15-13+/t19?,20-,22-,23+,25?/m0/s1 |
| InChIKey | XQXISKMFTGRDAC-QDRRAHEFSA-N |
| XLogP | 5.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|