C22H32BBrO2S — CID 90764370
CID 90764370 (PubChem CID 90764370) has the molecular formula C22H32BBrO2S and a molecular weight of 451.28 g/mol.
| Compound Name | CID 90764370 |
|---|---|
| PubChem CID | 90764370 |
| Molecular Formula | C22H32BBrO2S |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | — |
| SMILES | [B]C1CC(O)[C@H](CC=CCCCC)[C@H]1/C=C/[C@@H](O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C22H32BBrO2S/c1-3-4-5-6-7-8-19-18(20(23)14-22(19)26)12-10-16(25)9-11-17-13-21(24)15(2)27-17/h6-7,10,12-13,16,18-20,22,25-26H,3-5,8-9,11,14H2,1-2H3/b7-6?,12-10+/t16-,18+,19+,20?,22?/m0/s1 |
| InChIKey | KBOFPNBGZKVLNP-XGKDIKHHSA-N |
| XLogP | 5.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|