C24H37ClO4S — CID 18710629
4-[(E)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-[(E)-8-hydroxy-7-methyloct-2-enyl]cyclopentane-1,3-diol (PubChem CID 18710629) has the molecular formula C24H37ClO4S and a molecular weight of 457.08 g/mol. Its IUPAC name is 4-[(E)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-[(E)-8-hydroxy-7-methyloct-2-enyl]cyclopentane-1,3-diol.
| Compound Name | 4-[(E)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-[(E)-8-hydroxy-7-methyloct-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 18710629 |
| Molecular Formula | C24H37ClO4S |
| Molecular Weight | 457.08 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-[(E)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-[(E)-8-hydroxy-7-methyloct-2-enyl]cyclopentane-1,3-diol |
| SMILES | Cc1sc(CCC(O)/C=C/C2C(O)CC(O)C2C/C=C/CCCC(C)CO)cc1Cl |
| InChI | InChI=1S/C24H37ClO4S/c1-16(15-26)7-5-3-4-6-8-20-21(24(29)14-23(20)28)12-10-18(27)9-11-19-13-22(25)17(2)30-19/h4,6,10,12-13,16,18,20-21,23-24,26-29H,3,5,7-9,11,14-15H2,1-2H3/b6-4+,12-10+ |
| InChIKey | HAYZIADSBKXMIR-QGCGKJESSA-N |
| XLogP | 4.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.08 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|