C22H32O5S — CID 20698854
(E)-7-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-(5-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 20698854) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is (E)-7-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-(5-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-(5-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 20698854 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (E)-7-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-(5-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cc(CCC(O)/C=C/C2C(O)CC(O)C2C/C=C/CCCC(=O)O)cs1 |
| InChI | InChI=1S/C22H32O5S/c1-15-12-16(14-28-15)8-9-17(23)10-11-19-18(20(24)13-21(19)25)6-4-2-3-5-7-22(26)27/h2,4,10-12,14,17-21,23-25H,3,5-9,13H2,1H3,(H,26,27)/b4-2+,11-10+ |
| InChIKey | OVNRHAANPLLRPI-PKQAVJSRSA-N |
| XLogP | 3.47 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|