C21H28Cl2O5S — CID 20698846
(E)-7-[2-[(E)-5-(2,5-dichlorothiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 20698846) has the molecular formula C21H28Cl2O5S and a molecular weight of 463.42 g/mol. Its IUPAC name is (E)-7-[2-[(E)-5-(2,5-dichlorothiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[(E)-5-(2,5-dichlorothiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 20698846 |
| Molecular Formula | C21H28Cl2O5S |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (E)-7-[2-[(E)-5-(2,5-dichlorothiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C(O)CC(O)C1/C=C/C(O)CCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C21H28Cl2O5S/c22-19-11-13(21(23)29-19)7-8-14(24)9-10-16-15(17(25)12-18(16)26)5-3-1-2-4-6-20(27)28/h1,3,9-11,14-18,24-26H,2,4-8,12H2,(H,27,28)/b3-1+,10-9+ |
| InChIKey | ALUCEWLCJFGQOC-LMWSEPEPSA-N |
| XLogP | 4.46 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|