C23H33BrO5S — CID 59959281
(Z)-7-[(1R,2R)-2-[(E)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 59959281) has the molecular formula C23H33BrO5S and a molecular weight of 501.48 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(E)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(E)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59959281 |
| Molecular Formula | C23H33BrO5S |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(E)-5-(4-bromo-2,5-dimethylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1sc(C)c(CCC(O)/C=C/[C@H]2C(O)CC(O)[C@@H]2C/C=C\CCCC(=O)O)c1Br |
| InChI | InChI=1S/C23H33BrO5S/c1-14-17(23(24)15(2)30-14)11-9-16(25)10-12-19-18(20(26)13-21(19)27)7-5-3-4-6-8-22(28)29/h3,5,10,12,16,18-21,25-27H,4,6-9,11,13H2,1-2H3,(H,28,29)/b5-3-,12-10+/t16?,18-,19-,20?,21?/m1/s1 |
| InChIKey | CWSWWTHZNPUFPU-HAACDKGHSA-N |
| XLogP | 4.54 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|