C22H31Br2NO4S — CID 54213489
7-[(1R,2R)-2-[5-(3,4-dibromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide (PubChem CID 54213489) has the molecular formula C22H31Br2NO4S and a molecular weight of 565.37 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[5-(3,4-dibromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide.
| Compound Name | 7-[(1R,2R)-2-[5-(3,4-dibromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 54213489 |
| Molecular Formula | C22H31Br2NO4S |
| Molecular Weight | 565.37 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | 7-[(1R,2R)-2-[5-(3,4-dibromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide |
| SMILES | Cc1sc(CCC(O)C=C[C@H]2C(O)CC(O)[C@@H]2CC=CCCCC(N)=O)c(Br)c1Br |
| InChI | InChI=1S/C22H31Br2NO4S/c1-13-21(23)22(24)19(30-13)11-9-14(26)8-10-16-15(17(27)12-18(16)28)6-4-2-3-5-7-20(25)29/h2,4,8,10,14-18,26-28H,3,5-7,9,11-12H2,1H3,(H2,25,29)/t14?,15-,16-,17?,18?/m1/s1 |
| InChIKey | PXNZJIWKIQNHFT-NRXNZLANSA-N |
| XLogP | 4.39 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|