C21H29FO5S — CID 91206995
7-[(1R,2R,3R,5S)-2-[(3S)-5-(3-fluorothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91206995) has the molecular formula C21H29FO5S and a molecular weight of 412.52 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3S)-5-(3-fluorothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3S)-5-(3-fluorothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91206995 |
| Molecular Formula | C21H29FO5S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3S)-5-(3-fluorothiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)CCc2sccc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C21H29FO5S/c22-17-11-12-28-20(17)10-8-14(23)7-9-16-15(18(24)13-19(16)25)5-3-1-2-4-6-21(26)27/h1,3,7,9,11-12,14-16,18-19,23-25H,2,4-6,8,10,13H2,(H,26,27)/t14-,15-,16-,18+,19-/m1/s1 |
| InChIKey | QBEUPRURZVOXLX-LLLOQXOTSA-N |
| XLogP | 3.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|