C22H32ClNO4S — CID 158305663
(Z)-7-[(1R,2R,5S)-2-[(E,3S)-5-(2-chloro-5-methylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide (PubChem CID 158305663) has the molecular formula C22H32ClNO4S and a molecular weight of 442.02 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[(E,3S)-5-(2-chloro-5-methylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[(E,3S)-5-(2-chloro-5-methylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 158305663 |
| Molecular Formula | C22H32ClNO4S |
| Molecular Weight | 442.02 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[(E,3S)-5-(2-chloro-5-methylthiophen-3-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enamide |
| SMILES | Cc1cc(CC[C@H](O)/C=C/[C@H]2C(O)C[C@H](O)[C@@H]2C/C=C\CCCC(N)=O)c(Cl)s1 |
| InChI | InChI=1S/C22H32ClNO4S/c1-14-12-15(22(23)29-14)8-9-16(25)10-11-18-17(19(26)13-20(18)27)6-4-2-3-5-7-21(24)28/h2,4,10-12,16-20,25-27H,3,5-9,13H2,1H3,(H2,24,28)/b4-2-,11-10+/t16-,17+,18+,19-,20?/m0/s1 |
| InChIKey | GNAXRCLAGDEIPD-YVCWOKFWSA-N |
| XLogP | 3.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.02 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|