C23H35ClO5S — CID 22628711
4-[(E)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(E)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol (PubChem CID 22628711) has the molecular formula C23H35ClO5S and a molecular weight of 459.05 g/mol. Its IUPAC name is 4-[(E)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(E)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol.
| Compound Name | 4-[(E)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(E)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 22628711 |
| Molecular Formula | C23H35ClO5S |
| Molecular Weight | 459.05 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-[(E)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(E)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol |
| SMILES | COC(/C=C/C1C(O)CC(O)C1C/C=C/CCCC(O)CO)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C23H35ClO5S/c1-29-17(8-10-18-11-13-23(24)30-18)9-12-20-19(21(27)14-22(20)28)7-5-3-2-4-6-16(26)15-25/h3,5,9,11-13,16-17,19-22,25-28H,2,4,6-8,10,14-15H2,1H3/b5-3+,12-9+ |
| InChIKey | PWRFKPBBHOXHNA-OYTCOTEHSA-N |
| XLogP | 3.73 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.05 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|