C23H33ClO5S — CID 70157521
8-[(1R,2R,3R,5S)-2-[(3S)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoct-6-en-2-one (PubChem CID 70157521) has the molecular formula C23H33ClO5S and a molecular weight of 457.03 g/mol. Its IUPAC name is 8-[(1R,2R,3R,5S)-2-[(3S)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoct-6-en-2-one.
| Compound Name | 8-[(1R,2R,3R,5S)-2-[(3S)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoct-6-en-2-one |
|---|---|
| PubChem CID | 70157521 |
| Molecular Formula | C23H33ClO5S |
| Molecular Weight | 457.03 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 8-[(1R,2R,3R,5S)-2-[(3S)-5-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]-1-hydroxyoct-6-en-2-one |
| SMILES | CO[C@H](C=C[C@@H]1[C@@H](CC=CCCCC(=O)CO)[C@@H](O)C[C@H]1O)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C23H33ClO5S/c1-29-17(8-10-18-11-13-23(24)30-18)9-12-20-19(21(27)14-22(20)28)7-5-3-2-4-6-16(26)15-25/h3,5,9,11-13,17,19-22,25,27-28H,2,4,6-8,10,14-15H2,1H3/t17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | AUWHZKAQWQNHBL-KMHBYZIFSA-N |
| XLogP | 3.94 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.03 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|