C22H32O6 — CID 91343438
7-[(1R)-2-[5-(furan-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91343438) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 7-[(1R)-2-[5-(furan-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R)-2-[5-(furan-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91343438 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 7-[(1R)-2-[5-(furan-2-yl)-3-methoxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | COC(C=CC1C(O)CC(O)[C@@H]1CC=CCCCC(=O)O)CCc1ccco1 |
| InChI | InChI=1S/C22H32O6/c1-27-16(10-11-17-7-6-14-28-17)12-13-19-18(20(23)15-21(19)24)8-4-2-3-5-9-22(25)26/h2,4,6-7,12-14,16,18-21,23-24H,3,5,8-11,15H2,1H3,(H,25,26)/t16?,18-,19?,20?,21?/m1/s1 |
| InChIKey | GSPXEYTTXZCEML-ORAHWAPJSA-N |
| XLogP | 3.34 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|