C23H35ClO5S — CID 70212391
cis-(1S,3R)-4-[(E,3S)-1-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(Z)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol (PubChem CID 70212391) has the molecular formula C23H35ClO5S and a molecular weight of 459.05 g/mol. Its IUPAC name is cis-(1S,3R)-4-[(E,3S)-1-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(Z)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol.
| Compound Name | cis-(1S,3R)-4-[(E,3S)-1-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(Z)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70212391 |
| Molecular Formula | C23H35ClO5S |
| Molecular Weight | 459.05 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | cis-(1S,3R)-4-[(E,3S)-1-(5-chlorothiophen-2-yl)-3-methoxypent-1-enyl]-5-[(Z)-7,8-dihydroxyoct-2-enyl]cyclopentane-1,3-diol |
| SMILES | CC[C@@H](/C=C(/c1ccc(Cl)s1)C1C(C/C=C\CCCC(O)CO)[C@@H](O)C[C@H]1O)OC |
| InChI | InChI=1S/C23H35ClO5S/c1-3-16(29-2)12-18(21-10-11-22(24)30-21)23-17(19(27)13-20(23)28)9-7-5-4-6-8-15(26)14-25/h5,7,10-12,15-17,19-20,23,25-28H,3-4,6,8-9,13-14H2,1-2H3/b7-5-,18-12-/t15?,16-,17?,19-,20+,23?/m0/s1 |
| InChIKey | YCPGMJZJILKUNC-VQZZTTDBSA-N |
| XLogP | 4.04 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.05 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|