C15H25BO3 — CID 89201023
CID 89201023 (PubChem CID 89201023) has the molecular formula C15H25BO3 and a molecular weight of 264.17 g/mol.
| Compound Name | CID 89201023 |
|---|---|
| PubChem CID | 89201023 |
| Molecular Formula | C15H25BO3 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | — |
| SMILES | [B]C(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H25BO3/c1-2-3-4-5-6-7-11-12(8-9-15(16)19)14(18)10-13(11)17/h5-6,8-9,11-15,17-19H,2-4,7,10H2,1H3/b6-5-,9-8+/t11-,12-,13+,14-,15?/m1/s1 |
| InChIKey | ZWESEBVISQBOLW-NAYOOMCQSA-N |
| XLogP | 1.52 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|