C20H36O2 — CID 20612560
4-[(E)-3-methylhex-1-enyl]-5-[(E)-oct-2-enyl]cyclopentane-1,3-diol (PubChem CID 20612560) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 4-[(E)-3-methylhex-1-enyl]-5-[(E)-oct-2-enyl]cyclopentane-1,3-diol.
| Compound Name | 4-[(E)-3-methylhex-1-enyl]-5-[(E)-oct-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 20612560 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 4-[(E)-3-methylhex-1-enyl]-5-[(E)-oct-2-enyl]cyclopentane-1,3-diol |
| SMILES | CCCCC/C=C/CC1C(O)CC(O)C1/C=C/C(C)CCC |
| InChI | InChI=1S/C20H36O2/c1-4-6-7-8-9-10-12-17-18(20(22)15-19(17)21)14-13-16(3)11-5-2/h9-10,13-14,16-22H,4-8,11-12,15H2,1-3H3/b10-9+,14-13+ |
| InChIKey | OLZRWMSJYZKZNE-LBSPPQMYSA-N |
| XLogP | 4.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|