C24H44O4 — CID 70623818
(1S,3R,4R,5R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-[(Z)-7-(2-methylpropoxy)hept-2-enyl]cyclopentane-1,3-diol (PubChem CID 70623818) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-[(Z)-7-(2-methylpropoxy)hept-2-enyl]cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4R,5R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-[(Z)-7-(2-methylpropoxy)hept-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70623818 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | (1S,3R,4R,5R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-[(Z)-7-(2-methylpropoxy)hept-2-enyl]cyclopentane-1,3-diol |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCCOCC(C)C)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C24H44O4/c1-4-5-9-12-20(25)14-15-22-21(23(26)17-24(22)27)13-10-7-6-8-11-16-28-18-19(2)3/h7,10,14-15,19-27H,4-6,8-9,11-13,16-18H2,1-3H3/b10-7-,15-14+/t20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | VLRGMFBMRPBHAL-LLIAINLHSA-N |
| XLogP | 4.63 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|