C22H39NO4S — CID 57142513
O-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl] N-methylcarbamothioate (PubChem CID 57142513) has the molecular formula C22H39NO4S and a molecular weight of 413.62 g/mol. Its IUPAC name is O-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl] N-methylcarbamothioate.
| Compound Name | O-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 57142513 |
| Molecular Formula | C22H39NO4S |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | O-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enyl] N-methylcarbamothioate |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1[C@@H](CC=CCCCCOC(=S)NC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H39NO4S/c1-3-4-8-11-17(24)13-14-19-18(20(25)16-21(19)26)12-9-6-5-7-10-15-27-22(28)23-2/h6,9,13-14,17-21,24-26H,3-5,7-8,10-12,15-16H2,1-2H3,(H,23,28)/t17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | WZWGDKRKSFOHTI-XIYVOTBMSA-N |
| XLogP | 3.48 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|