C23H34O5S — CID 91226530
7-[(1R)-3,5-dihydroxy-2-[3-methoxy-5-(2-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 91226530) has the molecular formula C23H34O5S and a molecular weight of 422.59 g/mol. Its IUPAC name is 7-[(1R)-3,5-dihydroxy-2-[3-methoxy-5-(2-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R)-3,5-dihydroxy-2-[3-methoxy-5-(2-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91226530 |
| Molecular Formula | C23H34O5S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 7-[(1R)-3,5-dihydroxy-2-[3-methoxy-5-(2-methylthiophen-3-yl)pent-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | COC(C=CC1C(O)CC(O)[C@@H]1CC=CCCCC(=O)O)CCc1ccsc1C |
| InChI | InChI=1S/C23H34O5S/c1-16-17(13-14-29-16)9-10-18(28-2)11-12-20-19(21(24)15-22(20)25)7-5-3-4-6-8-23(26)27/h3,5,11-14,18-22,24-25H,4,6-10,15H2,1-2H3,(H,26,27)/t18?,19-,20?,21?,22?/m1/s1 |
| InChIKey | AABGPRFJLBQYPK-ALBACLGNSA-N |
| XLogP | 4.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|