C24H35BrO4S — CID 91267419
methyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate (PubChem CID 91267419) has the molecular formula C24H35BrO4S and a molecular weight of 499.51 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91267419 |
| Molecular Formula | C24H35BrO4S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1C(O)C[C@@H](C)[C@@H]1C=C[C@@H](O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C24H35BrO4S/c1-16-14-23(27)21(8-6-4-5-7-9-24(28)29-3)20(16)13-11-18(26)10-12-19-15-22(25)17(2)30-19/h4,6,11,13,15-16,18,20-21,23,26-27H,5,7-10,12,14H2,1-3H3/t16-,18+,20+,21-,23?/m1/s1 |
| InChIKey | IYTMADWUMJLRIE-AYBQLMGISA-N |
| XLogP | 5.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|