C22H29BrO5S — CID 143191320
2-[(Z)-4-[(1R,2R,3R)-2-[(E)-5-(4-bromo-5-methylthiophen-2-yl)-3-oxopent-1-enyl]-5-hydroxy-3-methylcyclopentyl]but-2-enoxy]acetic acid (PubChem CID 143191320) has the molecular formula C22H29BrO5S and a molecular weight of 485.44 g/mol. Its IUPAC name is 2-[(Z)-4-[(1R,2R,3R)-2-[(E)-5-(4-bromo-5-methylthiophen-2-yl)-3-oxopent-1-enyl]-5-hydroxy-3-methylcyclopentyl]but-2-enoxy]acetic acid.
| Compound Name | 2-[(Z)-4-[(1R,2R,3R)-2-[(E)-5-(4-bromo-5-methylthiophen-2-yl)-3-oxopent-1-enyl]-5-hydroxy-3-methylcyclopentyl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 143191320 |
| Molecular Formula | C22H29BrO5S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 2-[(Z)-4-[(1R,2R,3R)-2-[(E)-5-(4-bromo-5-methylthiophen-2-yl)-3-oxopent-1-enyl]-5-hydroxy-3-methylcyclopentyl]but-2-enoxy]acetic acid |
| SMILES | Cc1sc(CCC(=O)/C=C/[C@H]2[C@H](C)CC(O)[C@@H]2C/C=C\COCC(=O)O)cc1Br |
| InChI | InChI=1S/C22H29BrO5S/c1-14-11-21(25)19(5-3-4-10-28-13-22(26)27)18(14)9-7-16(24)6-8-17-12-20(23)15(2)29-17/h3-4,7,9,12,14,18-19,21,25H,5-6,8,10-11,13H2,1-2H3,(H,26,27)/b4-3-,9-7+/t14-,18+,19-,21?/m1/s1 |
| InChIKey | WZUOVFRTUPHLPE-SMJXLGASSA-N |
| XLogP | 4.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|