C23H28BBrO4S — CID 58287840
CID 58287840 (PubChem CID 58287840) has the molecular formula C23H28BBrO4S and a molecular weight of 491.26 g/mol.
| Compound Name | CID 58287840 |
|---|---|
| PubChem CID | 58287840 |
| Molecular Formula | C23H28BBrO4S |
| Molecular Weight | 491.26 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H]1CC(O)[C@H](CC#CCCCC(=O)O)[C@H]1/C=C/C(=O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C23H28BBrO4S/c1-15-21(25)13-18(30-15)10-8-17(26)9-11-19-16(14-24)12-22(27)20(19)6-4-2-3-5-7-23(28)29/h9,11,13,16,19-20,22,27H,3,5-8,10,12,14H2,1H3,(H,28,29)/b11-9+/t16-,19-,20+,22?/m0/s1 |
| InChIKey | PSFIQQIKXREPKB-PLZATEEWSA-N |
| XLogP | 4.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|