C23H33BO4S2 — CID 58287826
CID 58287826 (PubChem CID 58287826) has the molecular formula C23H33BO4S2 and a molecular weight of 448.46 g/mol.
| Compound Name | CID 58287826 |
|---|---|
| PubChem CID | 58287826 |
| Molecular Formula | C23H33BO4S2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H]1CC(O)[C@H](C/C=C\CSCC(=O)O)[C@H]1/C=C/[C@@H](O)CCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C23H33BO4S2/c1-15-11-19(30-16(15)2)8-6-18(25)7-9-20-17(13-24)12-22(26)21(20)5-3-4-10-29-14-23(27)28/h3-4,7,9,11,17-18,20-22,25-26H,5-6,8,10,12-14H2,1-2H3,(H,27,28)/b4-3-,9-7+/t17-,18-,20-,21+,22?/m0/s1 |
| InChIKey | LHZDHKHEWVZTRD-JAKQXKAQSA-N |
| XLogP | 4.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|