C21H28BBrO5S — CID 58287854
CID 58287854 (PubChem CID 58287854) has the molecular formula C21H28BBrO5S and a molecular weight of 483.23 g/mol.
| Compound Name | CID 58287854 |
|---|---|
| PubChem CID | 58287854 |
| Molecular Formula | C21H28BBrO5S |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H]1CC(O)[C@H](C/C=C\CCCC(=O)O)[C@H]1/C=C/[C@@H](O)COc1cc(Br)cs1 |
| InChI | InChI=1S/C21H28BBrO5S/c22-11-14-9-19(25)18(5-3-1-2-4-6-20(26)27)17(14)8-7-16(24)12-28-21-10-15(23)13-29-21/h1,3,7-8,10,13-14,16-19,24-25H,2,4-6,9,11-12H2,(H,26,27)/b3-1-,8-7+/t14-,16+,17-,18+,19?/m0/s1 |
| InChIKey | LWJGGCNKXDJNBN-XMEZMIHJSA-N |
| XLogP | 4.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|