C22H29BrO5S — CID 58089054
(Z)-6-[(1R,2R)-2-[(E)-6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]oxyhex-5-enoic acid (PubChem CID 58089054) has the molecular formula C22H29BrO5S and a molecular weight of 485.44 g/mol. Its IUPAC name is (Z)-6-[(1R,2R)-2-[(E)-6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]oxyhex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2R)-2-[(E)-6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]oxyhex-5-enoic acid |
|---|---|
| PubChem CID | 58089054 |
| Molecular Formula | C22H29BrO5S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (Z)-6-[(1R,2R)-2-[(E)-6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]oxyhex-5-enoic acid |
| SMILES | Cc1sc(CCCC(=O)/C=C/[C@H]2CCC(O)[C@@H]2O/C=C\CCCC(=O)O)cc1Br |
| InChI | InChI=1S/C22H29BrO5S/c1-15-19(23)14-18(29-15)7-5-6-17(24)11-9-16-10-12-20(25)22(16)28-13-4-2-3-8-21(26)27/h4,9,11,13-14,16,20,22,25H,2-3,5-8,10,12H2,1H3,(H,26,27)/b11-9+,13-4-/t16-,20?,22+/m0/s1 |
| InChIKey | JTBIUIKORBASQR-LDSDSJJPSA-N |
| XLogP | 5.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|