C23H31BrO4S — CID 123235478
7-[(1R,2R)-2-[6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 123235478) has the molecular formula C23H31BrO4S and a molecular weight of 483.47 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 123235478 |
| Molecular Formula | C23H31BrO4S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 7-[(1R,2R)-2-[6-(4-bromo-5-methylthiophen-2-yl)-3-oxohex-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1sc(CCCC(=O)C=C[C@H]2CCC(O)[C@@H]2CC=CCCCC(=O)O)cc1Br |
| InChI | InChI=1S/C23H31BrO4S/c1-16-21(24)15-19(29-16)8-6-7-18(25)13-11-17-12-14-22(26)20(17)9-4-2-3-5-10-23(27)28/h2,4,11,13,15,17,20,22,26H,3,5-10,12,14H2,1H3,(H,27,28)/t17-,20+,22?/m0/s1 |
| InChIKey | LWHNWIDSTFJUEN-UNEGGNDLSA-N |
| XLogP | 5.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|