C22H31BrO4S — CID 91532757
7-[(1R,2R)-2-[5-(4-bromo-5-methylthiophen-2-yl)-3-oxopentyl]-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91532757) has the molecular formula C22H31BrO4S and a molecular weight of 471.46 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[5-(4-bromo-5-methylthiophen-2-yl)-3-oxopentyl]-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[5-(4-bromo-5-methylthiophen-2-yl)-3-oxopentyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91532757 |
| Molecular Formula | C22H31BrO4S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 7-[(1R,2R)-2-[5-(4-bromo-5-methylthiophen-2-yl)-3-oxopentyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1sc(CCC(=O)CC[C@H]2CCC(O)[C@@H]2CC=CCCCC(=O)O)cc1Br |
| InChI | InChI=1S/C22H31BrO4S/c1-15-20(23)14-18(28-15)12-11-17(24)10-8-16-9-13-21(25)19(16)6-4-2-3-5-7-22(26)27/h2,4,14,16,19,21,25H,3,5-13H2,1H3,(H,26,27)/t16-,19+,21?/m0/s1 |
| InChIKey | HBLVIKPKMCBBOU-FZWXSHBKSA-N |
| XLogP | 5.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|