C14H23NO5 — CID 54030190
8-[2-hydroxy-5-(nitromethyl)cyclopentyl]oct-6-enoic acid (PubChem CID 54030190) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 8-[2-hydroxy-5-(nitromethyl)cyclopentyl]oct-6-enoic acid.
| Compound Name | 8-[2-hydroxy-5-(nitromethyl)cyclopentyl]oct-6-enoic acid |
|---|---|
| PubChem CID | 54030190 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 8-[2-hydroxy-5-(nitromethyl)cyclopentyl]oct-6-enoic acid |
| SMILES | O=C(O)CCCCC=CCC1C(O)CCC1C[N+](=O)[O-] |
| InChI | InChI=1S/C14H23NO5/c16-13-9-8-11(10-15(19)20)12(13)6-4-2-1-3-5-7-14(17)18/h2,4,11-13,16H,1,3,5-10H2,(H,17,18) |
| InChIKey | LFARAAKBTQVDGD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|