C13H23NO5 — CID 21403618
7-[2-hydroxy-5-(nitromethyl)cyclopentyl]heptanoic acid (PubChem CID 21403618) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 7-[2-hydroxy-5-(nitromethyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[2-hydroxy-5-(nitromethyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 21403618 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 7-[2-hydroxy-5-(nitromethyl)cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)CCC1C[N+](=O)[O-] |
| InChI | InChI=1S/C13H23NO5/c15-12-8-7-10(9-14(18)19)11(12)5-3-1-2-4-6-13(16)17/h10-12,15H,1-9H2,(H,16,17) |
| InChIKey | CPSSVPOLGKEIEV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|