C16H28O4 — CID 21403747
6-[2-hydroxy-5-[(E)-3-hydroxypent-1-enyl]cyclopentyl]hexanoic acid (PubChem CID 21403747) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-[2-hydroxy-5-[(E)-3-hydroxypent-1-enyl]cyclopentyl]hexanoic acid.
| Compound Name | 6-[2-hydroxy-5-[(E)-3-hydroxypent-1-enyl]cyclopentyl]hexanoic acid |
|---|---|
| PubChem CID | 21403747 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 6-[2-hydroxy-5-[(E)-3-hydroxypent-1-enyl]cyclopentyl]hexanoic acid |
| SMILES | CCC(O)/C=C/C1CCC(O)C1CCCCCC(=O)O |
| InChI | InChI=1S/C16H28O4/c1-2-13(17)10-8-12-9-11-15(18)14(12)6-4-3-5-7-16(19)20/h8,10,12-15,17-18H,2-7,9,11H2,1H3,(H,19,20)/b10-8+ |
| InChIKey | FDKLVFDSCVYRJN-CSKARUKUSA-N |
| XLogP | 2.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|