C24H46O2 — CID 70547983
(1S,2R,3R)-3-(3-hydroxydec-1-enyl)-2-(6-methyloctyl)cyclopentan-1-ol (PubChem CID 70547983) has the molecular formula C24H46O2 and a molecular weight of 366.63 g/mol. Its IUPAC name is (1S,2R,3R)-3-(3-hydroxydec-1-enyl)-2-(6-methyloctyl)cyclopentan-1-ol.
| Compound Name | (1S,2R,3R)-3-(3-hydroxydec-1-enyl)-2-(6-methyloctyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 70547983 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | (1S,2R,3R)-3-(3-hydroxydec-1-enyl)-2-(6-methyloctyl)cyclopentan-1-ol |
| SMILES | CCCCCCCC(O)C=C[C@H]1CC[C@H](O)[C@@H]1CCCCCC(C)CC |
| InChI | InChI=1S/C24H46O2/c1-4-6-7-8-11-14-22(25)18-16-21-17-19-24(26)23(21)15-12-9-10-13-20(3)5-2/h16,18,20-26H,4-15,17,19H2,1-3H3/t20?,21-,22?,23+,24-/m0/s1 |
| InChIKey | ZLGVMDVCSLCAJP-DZOQWKQOSA-N |
| XLogP | 6.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|