C36H64O8 — CID 157005565
[(2S)-2-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 10-methyldodecanoate (PubChem CID 157005565) has the molecular formula C36H64O8 and a molecular weight of 624.90 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 10-methyldodecanoate.
| Compound Name | [(2S)-2-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 10-methyldodecanoate |
|---|---|
| PubChem CID | 157005565 |
| Molecular Formula | C36H64O8 |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.46 |
| IUPAC Name | [(2S)-2-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl] 10-methyldodecanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC[C@@H](O)COC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H64O8/c1-4-6-13-19-29(37)23-24-32-31(33(39)25-34(32)40)20-15-11-12-17-22-36(42)44-27-30(38)26-43-35(41)21-16-10-8-7-9-14-18-28(3)5-2/h23-24,28-32,34,37-38,40H,4-22,25-27H2,1-3H3/b24-23+/t28?,29-,30-,31+,32+,34+/m0/s1 |
| InChIKey | BVOPHORAGJJTLD-ZJDVAWAESA-N |
| XLogP | 7.00 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|