C31H54O7 — CID 10414878
3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl octanoate (PubChem CID 10414878) has the molecular formula C31H54O7 and a molecular weight of 538.77 g/mol. Its IUPAC name is 3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl octanoate.
| Compound Name | 3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl octanoate |
|---|---|
| PubChem CID | 10414878 |
| Molecular Formula | C31H54O7 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | 3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCOC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C31H54O7/c1-3-5-7-8-13-18-30(35)37-22-15-23-38-31(36)19-14-10-9-12-17-26-27(29(34)24-28(26)33)21-20-25(32)16-11-6-4-2/h20-21,25-27,29,32,34H,3-19,22-24H2,1-2H3/b21-20+/t25-,26+,27+,29+/m0/s1 |
| InChIKey | JUNNHHRLEBHIGU-BCDDFRSESA-N |
| XLogP | 6.23 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|