C31H54O8 — CID 157005355
[(2S)-1-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propan-2-yl] octanoate (PubChem CID 157005355) has the molecular formula C31H54O8 and a molecular weight of 554.77 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propan-2-yl] octanoate.
| Compound Name | [(2S)-1-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propan-2-yl] octanoate |
|---|---|
| PubChem CID | 157005355 |
| Molecular Formula | C31H54O8 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.38 |
| IUPAC Name | [(2S)-1-hydroxy-3-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]propan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C31H54O8/c1-3-5-7-8-14-18-31(37)39-25(22-32)23-38-30(36)17-13-10-9-12-16-26-27(29(35)21-28(26)34)20-19-24(33)15-11-6-4-2/h19-20,24-27,29,32-33,35H,3-18,21-23H2,1-2H3/b20-19+/t24-,25-,26+,27+,29+/m0/s1 |
| InChIKey | PCKLYYSBAAFYPO-BTMRCCCHSA-N |
| XLogP | 5.20 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|