C28H49Na2O9P — CID 46219744
disodium;8-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]octyl phosphate (PubChem CID 46219744) has the molecular formula C28H49Na2O9P and a molecular weight of 606.65 g/mol. Its IUPAC name is disodium;8-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]octyl phosphate.
| Compound Name | disodium;8-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]octyl phosphate |
|---|---|
| PubChem CID | 46219744 |
| Molecular Formula | C28H49Na2O9P |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | disodium;8-[7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoyloxy]octyl phosphate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OCCCCCCCCOP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C28H51O9P.2Na/c1-2-3-10-15-23(29)18-19-25-24(26(30)22-27(25)31)16-11-6-7-12-17-28(32)36-20-13-8-4-5-9-14-21-37-38(33,34)35;;/h18-19,23-25,27,29,31H,2-17,20-22H2,1H3,(H2,33,34,35);;/q;2*+1/p-2/b19-18+;;/t23-,24+,25+,27+;;/m0../s1 |
| InChIKey | DMDUSXZVBUDKBL-TWWLJTLBSA-L |
| XLogP | -1.87 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|