C30H52O5 — CID 70566710
[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] decanoate (PubChem CID 70566710) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] decanoate.
| Compound Name | [(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] decanoate |
|---|---|
| PubChem CID | 70566710 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C30H52O5/c1-3-5-7-8-9-12-16-20-30(34)35-23-17-13-10-11-15-19-26-27(29(33)24-28(26)32)22-21-25(31)18-14-6-4-2/h11,15,21-22,25-27,29,31,33H,3-10,12-14,16-20,23-24H2,1-2H3/b15-11-,22-21+/t25-,26+,27+,29+/m0/s1 |
| InChIKey | BJHJVDOFLCADMN-JGLGOBHTSA-N |
| XLogP | 6.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|