C24H38O7 — CID 57100557
4-[7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoxy]-4-oxobutanoic acid (PubChem CID 57100557) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is 4-[7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoxy]-4-oxobutanoic acid.
| Compound Name | 4-[7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57100557 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 4-[7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoxy]-4-oxobutanoic acid |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H38O7/c1-2-3-7-10-18(25)12-13-20-19(21(26)17-22(20)27)11-8-5-4-6-9-16-31-24(30)15-14-23(28)29/h5,8,12-13,18-20,22,25,27H,2-4,6-7,9-11,14-17H2,1H3,(H,28,29)/t18-,19+,20+,22+/m0/s1 |
| InChIKey | NOSBHKNSFFTRGB-GPQLQYNLSA-N |
| XLogP | 3.57 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|