C22H38O4 — CID 154004373
(Z)-7-[2-hydroxy-5-[(E)-3-hydroxydec-1-enyl]cyclopentyl]hept-4-enoic acid (PubChem CID 154004373) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (Z)-7-[2-hydroxy-5-[(E)-3-hydroxydec-1-enyl]cyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[2-hydroxy-5-[(E)-3-hydroxydec-1-enyl]cyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 154004373 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (Z)-7-[2-hydroxy-5-[(E)-3-hydroxydec-1-enyl]cyclopentyl]hept-4-enoic acid |
| SMILES | CCCCCCCC(O)/C=C/C1CCC(O)C1CC/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H38O4/c1-2-3-4-5-8-11-19(23)16-14-18-15-17-21(24)20(18)12-9-6-7-10-13-22(25)26/h6-7,14,16,18-21,23-24H,2-5,8-13,15,17H2,1H3,(H,25,26)/b7-6-,16-14+ |
| InChIKey | XIGAQOJOOPCIRP-VGGPMKHUSA-N |
| XLogP | 4.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|