C21H36O5 — CID 54126632
7-[(1R,2S,5R)-2-(5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl)-5-hydroxycyclopentyl]hept-4-enoic acid (PubChem CID 54126632) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 7-[(1R,2S,5R)-2-(5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl)-5-hydroxycyclopentyl]hept-4-enoic acid.
| Compound Name | 7-[(1R,2S,5R)-2-(5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl)-5-hydroxycyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 54126632 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 7-[(1R,2S,5R)-2-(5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl)-5-hydroxycyclopentyl]hept-4-enoic acid |
| SMILES | CCOCC(C)(C)C(O)C=C[C@@H]1CC[C@@H](O)[C@@H]1CCC=CCCC(=O)O |
| InChI | InChI=1S/C21H36O5/c1-4-26-15-21(2,3)19(23)14-12-16-11-13-18(22)17(16)9-7-5-6-8-10-20(24)25/h5-6,12,14,16-19,22-23H,4,7-11,13,15H2,1-3H3,(H,24,25)/t16-,17+,18+,19?/m0/s1 |
| InChIKey | NRKJXSKNYCFNAO-JCIRIWACSA-N |
| XLogP | 3.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|