C23H39ClO4 — CID 54275265
methyl 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-4-enoate (PubChem CID 54275265) has the molecular formula C23H39ClO4 and a molecular weight of 415.01 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-4-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 54275265 |
| Molecular Formula | C23H39ClO4 |
| Molecular Weight | 415.01 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-4-enoate |
| SMILES | CCCCC(C)(C)[C@H](O)C=C[C@@H]1[C@@H](CCC=CCCC(=O)OC)[C@H](Cl)C[C@H]1O |
| InChI | InChI=1S/C23H39ClO4/c1-5-6-15-23(2,3)21(26)14-13-18-17(19(24)16-20(18)25)11-9-7-8-10-12-22(27)28-4/h7-8,13-14,17-21,25-26H,5-6,9-12,15-16H2,1-4H3/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | RMYRTUMXUPQULV-PFAUGDHASA-N |
| XLogP | 5.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.01 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|