C21H31F3O5 — CID 70489371
methyl (E)-5-[(2R,3aR,4R,5R,6aR)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate (PubChem CID 70489371) has the molecular formula C21H31F3O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl (E)-5-[(2R,3aR,4R,5R,6aR)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate.
| Compound Name | methyl (E)-5-[(2R,3aR,4R,5R,6aR)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 70489371 |
| Molecular Formula | C21H31F3O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | methyl (E)-5-[(2R,3aR,4R,5R,6aR)-4-[(E,3R)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-fluoro-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoate |
| SMILES | CCCCC(F)(F)[C@H](O)/C=C/[C@@H]1[C@H]2C(F)[C@@H](/C=C/CCC(=O)OC)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C21H31F3O5/c1-3-4-11-21(23,24)17(26)10-9-13-14(25)12-16-19(13)20(22)15(29-16)7-5-6-8-18(27)28-2/h5,7,9-10,13-17,19-20,25-26H,3-4,6,8,11-12H2,1-2H3/b7-5+,10-9+/t13-,14+,15+,16+,17+,19+,20?/m0/s1 |
| InChIKey | IFWJDOFFEMSEFU-HCUKGWCWSA-N |
| XLogP | 3.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|