C22H34F2O5 — CID 70489063
methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 70489063) has the molecular formula C22H34F2O5 and a molecular weight of 416.51 g/mol. Its IUPAC name is methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 70489063 |
| Molecular Formula | C22H34F2O5 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCCCC(C)(F)[C@H](O)/C=C/[C@@H]1[C@H]2C(F)/C(=C/CCCC(=O)OC)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C22H34F2O5/c1-4-5-12-22(2,24)18(26)11-10-14-15(25)13-17-20(14)21(23)16(29-17)8-6-7-9-19(27)28-3/h8,10-11,14-15,17-18,20-21,25-26H,4-7,9,12-13H2,1-3H3/b11-10+,16-8-/t14-,15+,17+,18+,20+,21?,22?/m0/s1 |
| InChIKey | YKKIXGPUXCWDOK-OPZNWBALSA-N |
| XLogP | 3.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|