C21H33F2NaO4 — CID 173420373
sodium;(5Z)-5-[(3aR,4R,6aS)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid;hydride (PubChem CID 173420373) has the molecular formula C21H33F2NaO4 and a molecular weight of 410.48 g/mol. Its IUPAC name is sodium;(5Z)-5-[(3aR,4R,6aS)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid;hydride.
| Compound Name | sodium;(5Z)-5-[(3aR,4R,6aS)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid;hydride |
|---|---|
| PubChem CID | 173420373 |
| Molecular Formula | C21H33F2NaO4 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | sodium;(5Z)-5-[(3aR,4R,6aS)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid;hydride |
| SMILES | CCCCC(C)(F)[C@H](O)/C=C/[C@H]1CC[C@@H]2O/C(=C\CCCC(=O)O)C(F)[C@@H]21.[H-].[Na+] |
| InChI | InChI=1S/C21H32F2O4.Na.H/c1-3-4-13-21(2,23)17(24)12-10-14-9-11-15-19(14)20(22)16(27-15)7-5-6-8-18(25)26;;/h7,10,12,14-15,17,19-20,24H,3-6,8-9,11,13H2,1-2H3,(H,25,26);;/q;+1;-1/b12-10+,16-7-;;/t14-,15+,17-,19-,20?,21?;;/m1../s1 |
| InChIKey | BGKJSCXFTJUMIS-WJKIEAOESA-N |
| XLogP | 1.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|