C23H35F4NaO4 — CID 173420258
sodium;(E)-5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid;hydride (PubChem CID 173420258) has the molecular formula C23H35F4NaO4 and a molecular weight of 474.51 g/mol. Its IUPAC name is sodium;(E)-5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid;hydride.
| Compound Name | sodium;(E)-5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid;hydride |
|---|---|
| PubChem CID | 173420258 |
| Molecular Formula | C23H35F4NaO4 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | sodium;(E)-5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid;hydride |
| SMILES | CCCCC(C)([C@H](O)/C=C/[C@@H]1[C@H]2C(F)C(/C=C/CCC(=O)O)O[C@H]2C[C@H]1C)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C23H34F4O4.Na.H/c1-4-5-12-22(3,23(25,26)27)18(28)11-10-15-14(2)13-17-20(15)21(24)16(31-17)8-6-7-9-19(29)30;;/h6,8,10-11,14-18,20-21,28H,4-5,7,9,12-13H2,1-3H3,(H,29,30);;/q;+1;-1/b8-6+,11-10+;;/t14-,15+,16?,17+,18-,20-,21?,22?;;/m1../s1 |
| InChIKey | SDRULXMKTFNOOQ-JMVBCIAASA-N |
| XLogP | 2.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|