C21H31F2NaO5 — CID 70488574
sodium (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 70488574) has the molecular formula C21H31F2NaO5 and a molecular weight of 424.46 g/mol. Its IUPAC name is sodium (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | sodium (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 70488574 |
| Molecular Formula | C21H31F2NaO5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | sodium (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCCCC(C)(F)[C@H](O)/C=C/[C@@H]1[C@H]2C(F)/C(=C/CCCC(=O)[O-])O[C@@H]2C[C@H]1O.[Na+] |
| InChI | InChI=1S/C21H32F2O5.Na/c1-3-4-11-21(2,23)17(25)10-9-13-14(24)12-16-19(13)20(22)15(28-16)7-5-6-8-18(26)27;/h7,9-10,13-14,16-17,19-20,24-25H,3-6,8,11-12H2,1-2H3,(H,26,27);/q;+1/p-1/b10-9+,15-7-;/t13-,14+,16+,17+,19+,20?,21?;/m0./s1 |
| InChIKey | KPPWSEXAGWRBFQ-FHGZFILBSA-M |
| XLogP | -0.64 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|