C23H34F4O4 — CID 57126396
5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 57126396) has the molecular formula C23H34F4O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is 5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | 5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 57126396 |
| Molecular Formula | C23H34F4O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | CCCCC(C)([C@H](O)C=C[C@@H]1[C@H]2[C@H](F)C(=CCCCC(=O)O)O[C@@H]2C[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C23H34F4O4/c1-4-5-12-22(3,23(25,26)27)18(28)11-10-15-14(2)13-17-20(15)21(24)16(31-17)8-6-7-9-19(29)30/h8,10-11,14-15,17-18,20-21,28H,4-7,9,12-13H2,1-3H3,(H,29,30)/t14-,15+,17-,18-,20-,21-,22?/m1/s1 |
| InChIKey | ILQNBCQBMXVZBZ-AVRCLCJUSA-N |
| XLogP | 5.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|