C22H35FO5 — CID 70434968
(5Z)-5-[(3R,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 70434968) has the molecular formula C22H35FO5 and a molecular weight of 398.52 g/mol. Its IUPAC name is (5Z)-5-[(3R,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | (5Z)-5-[(3R,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 70434968 |
| Molecular Formula | C22H35FO5 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (5Z)-5-[(3R,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@@H]1[C@@H]2[C@H](C[C@H]1O)O/C(=C\CCCC(=O)O)[C@@H]2F |
| InChI | InChI=1S/C22H35FO5/c1-4-5-12-22(2,3)18(25)11-10-14-15(24)13-17-20(14)21(23)16(28-17)8-6-7-9-19(26)27/h8,10-11,14-15,17-18,20-21,24-25H,4-7,9,12-13H2,1-3H3,(H,26,27)/b11-10+,16-8-/t14-,15+,17-,18+,20+,21-/m0/s1 |
| InChIKey | SFOWQHAEPCGDFN-VNJMHUBNSA-N |
| XLogP | 3.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|