C22H32F4O5 — CID 70488412
(5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 70488412) has the molecular formula C22H32F4O5 and a molecular weight of 452.49 g/mol. Its IUPAC name is (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 70488412 |
| Molecular Formula | C22H32F4O5 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-5-hydroxy-4-[(E,3R)-3-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | CCCCC(C)([C@H](O)/C=C/[C@@H]1[C@H]2C(F)/C(=C/CCCC(=O)O)O[C@@H]2C[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C22H32F4O5/c1-3-4-11-21(2,22(24,25)26)17(28)10-9-13-14(27)12-16-19(13)20(23)15(31-16)7-5-6-8-18(29)30/h7,9-10,13-14,16-17,19-20,27-28H,3-6,8,11-12H2,1-2H3,(H,29,30)/b10-9+,15-7-/t13-,14+,16+,17+,19+,20?,21?/m0/s1 |
| InChIKey | SPYFACRQFCKYKT-XOKDPZJASA-N |
| XLogP | 4.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|